C17H30FN3 — CID 63699739
N'-[4-[(tert-butylamino)methyl]-2-fluorophenyl]-N,N,N'-trimethylpropane-1,3-diamine (PubChem CID 63699739) has the molecular formula C17H30FN3 and a molecular weight of 295.45 g/mol. Its IUPAC name is N'-[4-[(tert-butylamino)methyl]-2-fluorophenyl]-N,N,N'-trimethylpropane-1,3-diamine.
| Compound Name | N'-[4-[(tert-butylamino)methyl]-2-fluorophenyl]-N,N,N'-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63699739 |
| Molecular Formula | C17H30FN3 |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.24 |
| IUPAC Name | N'-[4-[(tert-butylamino)methyl]-2-fluorophenyl]-N,N,N'-trimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCN(C)c1ccc(CNC(C)(C)C)cc1F |
| InChI | InChI=1S/C17H30FN3/c1-17(2,3)19-13-14-8-9-16(15(18)12-14)21(6)11-7-10-20(4)5/h8-9,12,19H,7,10-11,13H2,1-6H3 |
| InChIKey | URYZTVMELRRKNW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|