C12H13F2N3O2 — CID 79891256
N-(cyanomethyl)-2-[2,6-difluoro-4-(methylaminomethyl)phenoxy]acetamide (PubChem CID 79891256) has the molecular formula C12H13F2N3O2 and a molecular weight of 269.25 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[2,6-difluoro-4-(methylaminomethyl)phenoxy]acetamide.
| Compound Name | N-(cyanomethyl)-2-[2,6-difluoro-4-(methylaminomethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 79891256 |
| Molecular Formula | C12H13F2N3O2 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N-(cyanomethyl)-2-[2,6-difluoro-4-(methylaminomethyl)phenoxy]acetamide |
| SMILES | CNCc1cc(F)c(OCC(=O)NCC#N)c(F)c1 |
| InChI | InChI=1S/C12H13F2N3O2/c1-16-6-8-4-9(13)12(10(14)5-8)19-7-11(18)17-3-2-15/h4-5,16H,3,6-7H2,1H3,(H,17,18) |
| InChIKey | CHQUDIVINRPPAE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|