C13H14F2N2O2 — CID 79891340
2-[2,6-difluoro-4-(methylaminomethyl)phenoxy]-N-prop-2-ynylacetamide (PubChem CID 79891340) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-(methylaminomethyl)phenoxy]-N-prop-2-ynylacetamide.
| Compound Name | 2-[2,6-difluoro-4-(methylaminomethyl)phenoxy]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 79891340 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-[2,6-difluoro-4-(methylaminomethyl)phenoxy]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)COc1c(F)cc(CNC)cc1F |
| InChI | InChI=1S/C13H14F2N2O2/c1-3-4-17-12(18)8-19-13-10(14)5-9(7-16-2)6-11(13)15/h1,5-6,16H,4,7-8H2,2H3,(H,17,18) |
| InChIKey | UJOHRZOPGREGLM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|