C12H20BrN5O — CID 106347577
2-[[5-bromo-2-(propylamino)pyrimidin-4-yl]amino]-3-methylbutanamide (PubChem CID 106347577) has the molecular formula C12H20BrN5O and a molecular weight of 330.23 g/mol. Its IUPAC name is 2-[[5-bromo-2-(propylamino)pyrimidin-4-yl]amino]-3-methylbutanamide.
| Compound Name | 2-[[5-bromo-2-(propylamino)pyrimidin-4-yl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106347577 |
| Molecular Formula | C12H20BrN5O |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-[[5-bromo-2-(propylamino)pyrimidin-4-yl]amino]-3-methylbutanamide |
| SMILES | CCCNc1ncc(Br)c(NC(C(N)=O)C(C)C)n1 |
| InChI | InChI=1S/C12H20BrN5O/c1-4-5-15-12-16-6-8(13)11(18-12)17-9(7(2)3)10(14)19/h6-7,9H,4-5H2,1-3H3,(H2,14,19)(H2,15,16,17,18) |
| InChIKey | BWJHTVMUTVPREI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |