About 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-3-methylbutanamide
2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-3-methylbutanamide (PubChem CID 106347643) has the molecular formula C10H15Cl2N5O
and a molecular weight of 292.17 g/mol. Its IUPAC name is 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-3-methylbutanamide.
Molecular Properties
| Compound Name | 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-3-methylbutanamide |
| PubChem CID | 106347643 |
| Molecular Formula | C10H15Cl2N5O |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-3-methylbutanamide |
| SMILES | CC(C)C(Nc1nc(NN)c(Cl)cc1Cl)C(N)=O |
| InChI | InChI=1S/C10H15Cl2N5O/c1-4(2)7(8(13)18)15-9-5(11)3-6(12)10(16-9)17-14/h3-4,7H,14H2,1-2H3,(H2,13,18)(H2,15,16,17) |
| InChIKey | NUQRAJQNSTUTNW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-3-methylbutanamide?
The IUPAC name of 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-3-methylbutanamide (CID 106347643) is 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-3-methylbutanamide.
What is the SMILES notation for 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-3-methylbutanamide?
The canonical SMILES for 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-3-methylbutanamide is CC(C)C(Nc1nc(NN)c(Cl)cc1Cl)C(N)=O.
What is the InChIKey of 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-3-methylbutanamide?
The InChIKey is NUQRAJQNSTUTNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15Cl2N5O/c1-4(2)7(8(13)18)15-9-5(11)3-6(12)10(16-9)17-14/h3-4,7H,14H2,1-2H3,(H2,13,18)(H2,15,16,17).
What are the key properties of 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-3-methylbutanamide?
2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-3-methylbutanamide has a molecular weight of 292.17 g/mol, XLogP of 1.60, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-3-methylbutanamide is sourced from PubChem (CID 106347643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).