C12H15Cl2N5O — CID 102762257
3,5-dichloro-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-6-hydrazinylpyridin-2-amine (PubChem CID 102762257) has the molecular formula C12H15Cl2N5O and a molecular weight of 316.19 g/mol. Its IUPAC name is 3,5-dichloro-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-6-hydrazinylpyridin-2-amine.
| Compound Name | 3,5-dichloro-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-6-hydrazinylpyridin-2-amine |
|---|---|
| PubChem CID | 102762257 |
| Molecular Formula | C12H15Cl2N5O |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 3,5-dichloro-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-6-hydrazinylpyridin-2-amine |
| SMILES | Cc1noc(C)c1C(C)Nc1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl2N5O/c1-5(10-6(2)19-20-7(10)3)16-11-8(13)4-9(14)12(17-11)18-15/h4-5H,15H2,1-3H3,(H2,16,17,18) |
| InChIKey | IHBVOBSMGOGXRJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|