C17H18N2O — CID 79242430
N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]naphthalen-2-amine (PubChem CID 79242430) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]naphthalen-2-amine.
| Compound Name | N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 79242430 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]naphthalen-2-amine |
| SMILES | Cc1noc(C)c1C(C)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H18N2O/c1-11(17-12(2)19-20-13(17)3)18-16-9-8-14-6-4-5-7-15(14)10-16/h4-11,18H,1-3H3 |
| InChIKey | RYDFOJPFDGISFR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |