C13H16N4OS — CID 115488708
5-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]pyridine-2-carbothioamide (PubChem CID 115488708) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 5-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]pyridine-2-carbothioamide.
| Compound Name | 5-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 115488708 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]pyridine-2-carbothioamide |
| SMILES | Cc1noc(C)c1C(C)Nc1ccc(C(N)=S)nc1 |
| InChI | InChI=1S/C13H16N4OS/c1-7(12-8(2)17-18-9(12)3)16-10-4-5-11(13(14)19)15-6-10/h4-7,16H,1-3H3,(H2,14,19) |
| InChIKey | AHZYYOSPUSFHSA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|