About 3-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]propanamide
3-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]propanamide (PubChem CID 68540665) has the molecular formula C14H16Cl2N6O
and a molecular weight of 355.23 g/mol. Its IUPAC name is 3-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]propanamide.
Molecular Properties
| Compound Name | 3-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]propanamide |
| PubChem CID | 68540665 |
| Molecular Formula | C14H16Cl2N6O |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 3-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]propanamide |
| SMILES | NC(=O)CCNc1nc(NCc2ccc(Cl)c(Cl)c2)ncc1N |
| InChI | InChI=1S/C14H16Cl2N6O/c15-9-2-1-8(5-10(9)16)6-20-14-21-7-11(17)13(22-14)19-4-3-12(18)23/h1-2,5,7H,3-4,6,17H2,(H2,18,23)(H2,19,20,21,22) |
| InChIKey | FMWFIYJOVFUDDL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]propanamide?
The IUPAC name of 3-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]propanamide (CID 68540665) is 3-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]propanamide.
What is the SMILES notation for 3-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]propanamide?
The canonical SMILES for 3-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]propanamide is NC(=O)CCNc1nc(NCc2ccc(Cl)c(Cl)c2)ncc1N.
What is the InChIKey of 3-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]propanamide?
The InChIKey is FMWFIYJOVFUDDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Cl2N6O/c15-9-2-1-8(5-10(9)16)6-20-14-21-7-11(17)13(22-14)19-4-3-12(18)23/h1-2,5,7H,3-4,6,17H2,(H2,18,23)(H2,19,20,21,22).
What are the key properties of 3-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]propanamide?
3-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]propanamide has a molecular weight of 355.23 g/mol, XLogP of 2.27, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]propanamide is sourced from PubChem (CID 68540665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).