C14H18Cl2N6O2S — CID 68541096
N-[2-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]ethyl]methanesulfonamide (PubChem CID 68541096) has the molecular formula C14H18Cl2N6O2S and a molecular weight of 405.31 g/mol. Its IUPAC name is N-[2-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 68541096 |
| Molecular Formula | C14H18Cl2N6O2S |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | N-[2-[[5-amino-2-[(3,4-dichlorophenyl)methylamino]pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1nc(NCc2ccc(Cl)c(Cl)c2)ncc1N |
| InChI | InChI=1S/C14H18Cl2N6O2S/c1-25(23,24)21-5-4-18-13-12(17)8-20-14(22-13)19-7-9-2-3-10(15)11(16)6-9/h2-3,6,8,21H,4-5,7,17H2,1H3,(H2,18,19,20,22) |
| InChIKey | YMTVHZCLPNNSDX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|