C18H18Cl2N5+ — CID 143285107
[5-amino-2-[2-(3,4-dichlorophenyl)ethylamino]pyrimidin-4-yl]-phenylazanium (PubChem CID 143285107) has the molecular formula C18H18Cl2N5+ and a molecular weight of 375.28 g/mol. Its IUPAC name is [5-amino-2-[2-(3,4-dichlorophenyl)ethylamino]pyrimidin-4-yl]-phenylazanium.
| Compound Name | [5-amino-2-[2-(3,4-dichlorophenyl)ethylamino]pyrimidin-4-yl]-phenylazanium |
|---|---|
| PubChem CID | 143285107 |
| Molecular Formula | C18H18Cl2N5+ |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [5-amino-2-[2-(3,4-dichlorophenyl)ethylamino]pyrimidin-4-yl]-phenylazanium |
| SMILES | Nc1cnc(NCCc2ccc(Cl)c(Cl)c2)nc1[NH2+]c1ccccc1 |
| InChI | InChI=1S/C18H17Cl2N5/c19-14-7-6-12(10-15(14)20)8-9-22-18-23-11-16(21)17(25-18)24-13-4-2-1-3-5-13/h1-7,10-11H,8-9,21H2,(H2,22,23,24,25)/p+1 |
| InChIKey | SRUVEBZCPUYOHW-UHFFFAOYSA-O |
| XLogP | 3.55 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|