C10H20N4 — CID 114988235
2-methyl-4-N-(4-methylpentyl)-1H-imidazole-4,5-diamine (PubChem CID 114988235) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 2-methyl-4-N-(4-methylpentyl)-1H-imidazole-4,5-diamine.
| Compound Name | 2-methyl-4-N-(4-methylpentyl)-1H-imidazole-4,5-diamine |
|---|---|
| PubChem CID | 114988235 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 2-methyl-4-N-(4-methylpentyl)-1H-imidazole-4,5-diamine |
| SMILES | Cc1nc(NCCCC(C)C)c(N)[nH]1 |
| InChI | InChI=1S/C10H20N4/c1-7(2)5-4-6-12-10-9(11)13-8(3)14-10/h7,12H,4-6,11H2,1-3H3,(H,13,14) |
| InChIKey | HCFXMKDEXXFRLR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|