About 5-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]pentanamide
5-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]pentanamide (PubChem CID 106241669) has the molecular formula C11H19N5O
and a molecular weight of 237.31 g/mol. Its IUPAC name is 5-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]pentanamide.
Molecular Properties
| Compound Name | 5-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]pentanamide |
| PubChem CID | 106241669 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 5-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]pentanamide |
| SMILES | Cc1nc(N)c(C)c(NCCCCC(N)=O)n1 |
| InChI | InChI=1S/C11H19N5O/c1-7-10(13)15-8(2)16-11(7)14-6-4-3-5-9(12)17/h3-6H2,1-2H3,(H2,12,17)(H3,13,14,15,16) |
| InChIKey | CNIGXJXQNGSJJG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]pentanamide?
The IUPAC name of 5-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]pentanamide (CID 106241669) is 5-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]pentanamide.
What is the SMILES notation for 5-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]pentanamide?
The canonical SMILES for 5-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]pentanamide is Cc1nc(N)c(C)c(NCCCCC(N)=O)n1.
What is the InChIKey of 5-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]pentanamide?
The InChIKey is CNIGXJXQNGSJJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5O/c1-7-10(13)15-8(2)16-11(7)14-6-4-3-5-9(12)17/h3-6H2,1-2H3,(H2,12,17)(H3,13,14,15,16).
What are the key properties of 5-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]pentanamide?
5-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]pentanamide has a molecular weight of 237.31 g/mol, XLogP of 0.74, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]pentanamide is sourced from PubChem (CID 106241669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).