C13H21N5O4 — CID 171383901
ethyl 5-amino-2-(dimethylamino)-6-[(2-ethoxy-2-oxoethyl)amino]pyrimidine-4-carboxylate (PubChem CID 171383901) has the molecular formula C13H21N5O4 and a molecular weight of 311.34 g/mol. Its IUPAC name is ethyl 5-amino-2-(dimethylamino)-6-[(2-ethoxy-2-oxoethyl)amino]pyrimidine-4-carboxylate.
| Compound Name | ethyl 5-amino-2-(dimethylamino)-6-[(2-ethoxy-2-oxoethyl)amino]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 171383901 |
| Molecular Formula | C13H21N5O4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | ethyl 5-amino-2-(dimethylamino)-6-[(2-ethoxy-2-oxoethyl)amino]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)CNc1nc(N(C)C)nc(C(=O)OCC)c1N |
| InChI | InChI=1S/C13H21N5O4/c1-5-21-8(19)7-15-11-9(14)10(12(20)22-6-2)16-13(17-11)18(3)4/h5-7,14H2,1-4H3,(H,15,16,17) |
| InChIKey | PCQNVVRPRJGQCA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |