C27H31N5O8 — CID 174488881
ethyl 5-amino-2,6-bis[2-(2-ethoxy-2-oxoethoxy)anilino]pyrimidine-4-carboxylate (PubChem CID 174488881) has the molecular formula C27H31N5O8 and a molecular weight of 553.57 g/mol. Its IUPAC name is ethyl 5-amino-2,6-bis[2-(2-ethoxy-2-oxoethoxy)anilino]pyrimidine-4-carboxylate.
| Compound Name | ethyl 5-amino-2,6-bis[2-(2-ethoxy-2-oxoethoxy)anilino]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 174488881 |
| Molecular Formula | C27H31N5O8 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | ethyl 5-amino-2,6-bis[2-(2-ethoxy-2-oxoethoxy)anilino]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)COc1ccccc1Nc1nc(Nc2ccccc2OCC(=O)OCC)c(N)c(C(=O)OCC)n1 |
| InChI | InChI=1S/C27H31N5O8/c1-4-36-21(33)15-39-19-13-9-7-11-17(19)29-25-23(28)24(26(35)38-6-3)31-27(32-25)30-18-12-8-10-14-20(18)40-16-22(34)37-5-2/h7-14H,4-6,15-16,28H2,1-3H3,(H2,29,30,31,32) |
| InChIKey | YXMYLCWUHNYGSO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 173.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|