C14H23N4O4S+ — CID 9186167
4-(4-methylpiperazin-4-ium-1-yl)-3-nitro-N-propan-2-ylbenzenesulfonamide (PubChem CID 9186167) has the molecular formula C14H23N4O4S+ and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-(4-methylpiperazin-4-ium-1-yl)-3-nitro-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-(4-methylpiperazin-4-ium-1-yl)-3-nitro-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 9186167 |
| Molecular Formula | C14H23N4O4S+ |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4-(4-methylpiperazin-4-ium-1-yl)-3-nitro-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(N2CC[NH+](C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H22N4O4S/c1-11(2)15-23(21,22)12-4-5-13(14(10-12)18(19)20)17-8-6-16(3)7-9-17/h4-5,10-11,15H,6-9H2,1-3H3/p+1 |
| InChIKey | ZZSHHNQKNFTDRT-UHFFFAOYSA-O |
| XLogP | -0.38 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|