C18H29N4O4S+ — CID 9311501
1-methyl-4-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-1,4-diazepan-1-ium (PubChem CID 9311501) has the molecular formula C18H29N4O4S+ and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-methyl-4-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-1,4-diazepan-1-ium.
| Compound Name | 1-methyl-4-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-1,4-diazepan-1-ium |
|---|---|
| PubChem CID | 9311501 |
| Molecular Formula | C18H29N4O4S+ |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 1-methyl-4-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-1,4-diazepan-1-ium |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(N3CCC[NH+](C)CC3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C18H28N4O4S/c1-15-6-10-21(11-7-15)27(25,26)16-4-5-17(18(14-16)22(23)24)20-9-3-8-19(2)12-13-20/h4-5,14-15H,3,6-13H2,1-2H3/p+1 |
| InChIKey | HOQDMCREJYAOOL-UHFFFAOYSA-O |
| XLogP | 0.74 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|