C18H27N3O4S2 — CID 42962412
4-[4-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-1,4-thiazepane (PubChem CID 42962412) has the molecular formula C18H27N3O4S2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 4-[4-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-1,4-thiazepane.
| Compound Name | 4-[4-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-1,4-thiazepane |
|---|---|
| PubChem CID | 42962412 |
| Molecular Formula | C18H27N3O4S2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 4-[4-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-1,4-thiazepane |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(N3CCCSCC3)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C18H27N3O4S2/c1-14-10-15(2)13-20(12-14)27(24,25)16-4-5-17(18(11-16)21(22)23)19-6-3-8-26-9-7-19/h4-5,11,14-15H,3,6-10,12-13H2,1-2H3 |
| InChIKey | OCOBDFAHIXDRMF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|