C19H21N5O4S — CID 9212250
1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]benzotriazole (PubChem CID 9212250) has the molecular formula C19H21N5O4S and a molecular weight of 415.48 g/mol. Its IUPAC name is 1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]benzotriazole.
| Compound Name | 1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]benzotriazole |
|---|---|
| PubChem CID | 9212250 |
| Molecular Formula | C19H21N5O4S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]benzotriazole |
| SMILES | C[C@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(-n3nnc4ccccc43)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C19H21N5O4S/c1-13-9-14(2)12-22(11-13)29(27,28)15-7-8-18(19(10-15)24(25)26)23-17-6-4-3-5-16(17)20-21-23/h3-8,10,13-14H,9,11-12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | ZSCNDYHPXJLUTI-KBPBESRZSA-N |
| XLogP | 3.00 |
| TPSA | 111.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|