C20H33N4O4S+ — CID 9182271
1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-4-propylpiperazin-4-ium (PubChem CID 9182271) has the molecular formula C20H33N4O4S+ and a molecular weight of 425.58 g/mol. Its IUPAC name is 1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-4-propylpiperazin-4-ium.
| Compound Name | 1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-4-propylpiperazin-4-ium |
|---|---|
| PubChem CID | 9182271 |
| Molecular Formula | C20H33N4O4S+ |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-4-propylpiperazin-4-ium |
| SMILES | CCC[NH+]1CCN(c2ccc(S(=O)(=O)N3C[C@@H](C)C[C@H](C)C3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H32N4O4S/c1-4-7-21-8-10-22(11-9-21)19-6-5-18(13-20(19)24(25)26)29(27,28)23-14-16(2)12-17(3)15-23/h5-6,13,16-17H,4,7-12,14-15H2,1-3H3/p+1/t16-,17-/m0/s1 |
| InChIKey | WMIQIWKSQQSVNW-IRXDYDNUSA-O |
| XLogP | 1.38 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|