C14H21N5O5S — CID 18285328
4-[2-nitro-4-(propan-2-ylsulfamoyl)phenyl]piperazine-2-carboxamide (PubChem CID 18285328) has the molecular formula C14H21N5O5S and a molecular weight of 371.42 g/mol. Its IUPAC name is 4-[2-nitro-4-(propan-2-ylsulfamoyl)phenyl]piperazine-2-carboxamide.
| Compound Name | 4-[2-nitro-4-(propan-2-ylsulfamoyl)phenyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 18285328 |
| Molecular Formula | C14H21N5O5S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 4-[2-nitro-4-(propan-2-ylsulfamoyl)phenyl]piperazine-2-carboxamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(N2CCNC(C(N)=O)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H21N5O5S/c1-9(2)17-25(23,24)10-3-4-12(13(7-10)19(21)22)18-6-5-16-11(8-18)14(15)20/h3-4,7,9,11,16-17H,5-6,8H2,1-2H3,(H2,15,20) |
| InChIKey | HMEFLJGQTPJLMF-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 147.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|