C20H18N4O7S — CID 3563698
N-[4-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]phenyl]-3-nitrobenzenesulfonamide (PubChem CID 3563698) has the molecular formula C20H18N4O7S and a molecular weight of 458.45 g/mol. Its IUPAC name is N-[4-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]phenyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[4-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]phenyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3563698 |
| Molecular Formula | C20H18N4O7S |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | N-[4-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]phenyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccc(NS(=O)(=O)c3cccc([N+](=O)[O-])c3)cc2)c(C)o1 |
| InChI | InChI=1S/C20H18N4O7S/c1-12-10-18(13(2)31-12)20(26)22-21-19(25)14-6-8-15(9-7-14)23-32(29,30)17-5-3-4-16(11-17)24(27)28/h3-11,23H,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | RCLCMEJMVWCIGL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|