C21H19N3O5S — CID 26538703
N-(2,4-dimethylphenyl)-4-[(3-nitrophenyl)sulfonylamino]benzamide (PubChem CID 26538703) has the molecular formula C21H19N3O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-[(3-nitrophenyl)sulfonylamino]benzamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-[(3-nitrophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 26538703 |
| Molecular Formula | C21H19N3O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-[(3-nitrophenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(NS(=O)(=O)c3cccc([N+](=O)[O-])c3)cc2)c(C)c1 |
| InChI | InChI=1S/C21H19N3O5S/c1-14-6-11-20(15(2)12-14)22-21(25)16-7-9-17(10-8-16)23-30(28,29)19-5-3-4-18(13-19)24(26)27/h3-13,23H,1-2H3,(H,22,25) |
| InChIKey | WYCBIWZVNLLYNF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|