C11H10Cl2N2O4S2 — CID 39769818
N'-(2,5-dichlorothiophen-3-yl)sulfonyl-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 39769818) has the molecular formula C11H10Cl2N2O4S2 and a molecular weight of 369.25 g/mol. Its IUPAC name is N'-(2,5-dichlorothiophen-3-yl)sulfonyl-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-(2,5-dichlorothiophen-3-yl)sulfonyl-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 39769818 |
| Molecular Formula | C11H10Cl2N2O4S2 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | N'-(2,5-dichlorothiophen-3-yl)sulfonyl-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNS(=O)(=O)c2cc(Cl)sc2Cl)c(C)o1 |
| InChI | InChI=1S/C11H10Cl2N2O4S2/c1-5-3-7(6(2)19-5)11(16)14-15-21(17,18)8-4-9(12)20-10(8)13/h3-4,15H,1-2H3,(H,14,16) |
| InChIKey | KKEKYVIYUMZZNQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|