C19H18N2O4S — CID 134040433
2,5-dimethyl-N'-(2-phenylphenyl)sulfonylfuran-3-carbohydrazide (PubChem CID 134040433) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2,5-dimethyl-N'-(2-phenylphenyl)sulfonylfuran-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-(2-phenylphenyl)sulfonylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 134040433 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2,5-dimethyl-N'-(2-phenylphenyl)sulfonylfuran-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNS(=O)(=O)c2ccccc2-c2ccccc2)c(C)o1 |
| InChI | InChI=1S/C19H18N2O4S/c1-13-12-17(14(2)25-13)19(22)20-21-26(23,24)18-11-7-6-10-16(18)15-8-4-3-5-9-15/h3-12,21H,1-2H3,(H,20,22) |
| InChIKey | ZBBAXJJIDRDQPE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|