C11H7Cl2FN2O3S2 — CID 29099080
N'-(2,5-dichlorothiophen-3-yl)sulfonyl-2-fluorobenzohydrazide (PubChem CID 29099080) has the molecular formula C11H7Cl2FN2O3S2 and a molecular weight of 369.23 g/mol. Its IUPAC name is N'-(2,5-dichlorothiophen-3-yl)sulfonyl-2-fluorobenzohydrazide.
| Compound Name | N'-(2,5-dichlorothiophen-3-yl)sulfonyl-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 29099080 |
| Molecular Formula | C11H7Cl2FN2O3S2 |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 367.93 |
| IUPAC Name | N'-(2,5-dichlorothiophen-3-yl)sulfonyl-2-fluorobenzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1cc(Cl)sc1Cl)c1ccccc1F |
| InChI | InChI=1S/C11H7Cl2FN2O3S2/c12-9-5-8(10(13)20-9)21(18,19)16-15-11(17)6-3-1-2-4-7(6)14/h1-5,16H,(H,15,17) |
| InChIKey | IHBIOTQPZJLPKU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|