C14H13FN2O4S — CID 60532960
N'-(2-fluoro-5-methylphenyl)sulfonyl-2-hydroxybenzohydrazide (PubChem CID 60532960) has the molecular formula C14H13FN2O4S and a molecular weight of 324.33 g/mol. Its IUPAC name is N'-(2-fluoro-5-methylphenyl)sulfonyl-2-hydroxybenzohydrazide.
| Compound Name | N'-(2-fluoro-5-methylphenyl)sulfonyl-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 60532960 |
| Molecular Formula | C14H13FN2O4S |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | N'-(2-fluoro-5-methylphenyl)sulfonyl-2-hydroxybenzohydrazide |
| SMILES | Cc1ccc(F)c(S(=O)(=O)NNC(=O)c2ccccc2O)c1 |
| InChI | InChI=1S/C14H13FN2O4S/c1-9-6-7-11(15)13(8-9)22(20,21)17-16-14(19)10-4-2-3-5-12(10)18/h2-8,17-18H,1H3,(H,16,19) |
| InChIKey | GAIQBAMFLNTIDI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|