C11H5Cl2FINO3S2 — CID 112839247
N-(2,5-dichlorothiophen-3-yl)sulfonyl-4-fluoro-2-iodobenzamide (PubChem CID 112839247) has the molecular formula C11H5Cl2FINO3S2 and a molecular weight of 480.11 g/mol. Its IUPAC name is N-(2,5-dichlorothiophen-3-yl)sulfonyl-4-fluoro-2-iodobenzamide.
| Compound Name | N-(2,5-dichlorothiophen-3-yl)sulfonyl-4-fluoro-2-iodobenzamide |
|---|---|
| PubChem CID | 112839247 |
| Molecular Formula | C11H5Cl2FINO3S2 |
| Molecular Weight | 480.11 g/mol |
| Exact Mass | 478.81 |
| IUPAC Name | N-(2,5-dichlorothiophen-3-yl)sulfonyl-4-fluoro-2-iodobenzamide |
| SMILES | O=C(NS(=O)(=O)c1cc(Cl)sc1Cl)c1ccc(F)cc1I |
| InChI | InChI=1S/C11H5Cl2FINO3S2/c12-9-4-8(10(13)20-9)21(18,19)16-11(17)6-2-1-5(14)3-7(6)15/h1-4H,(H,16,17) |
| InChIKey | ZJBFXPPCWWULPF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.11 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|