C9H10FIN2O — CID 103626497
4-fluoro-2-iodo-N',N'-dimethylbenzohydrazide (PubChem CID 103626497) has the molecular formula C9H10FIN2O and a molecular weight of 308.09 g/mol. Its IUPAC name is 4-fluoro-2-iodo-N',N'-dimethylbenzohydrazide.
| Compound Name | 4-fluoro-2-iodo-N',N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 103626497 |
| Molecular Formula | C9H10FIN2O |
| Molecular Weight | 308.09 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 4-fluoro-2-iodo-N',N'-dimethylbenzohydrazide |
| SMILES | CN(C)NC(=O)c1ccc(F)cc1I |
| InChI | InChI=1S/C9H10FIN2O/c1-13(2)12-9(14)7-4-3-6(10)5-8(7)11/h3-5H,1-2H3,(H,12,14) |
| InChIKey | BWCKMSHMGTZJJL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.09 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|