C14H19FINO — CID 103708356
4-fluoro-2-iodo-N-(4-methylhexan-2-yl)benzamide (PubChem CID 103708356) has the molecular formula C14H19FINO and a molecular weight of 363.21 g/mol. Its IUPAC name is 4-fluoro-2-iodo-N-(4-methylhexan-2-yl)benzamide.
| Compound Name | 4-fluoro-2-iodo-N-(4-methylhexan-2-yl)benzamide |
|---|---|
| PubChem CID | 103708356 |
| Molecular Formula | C14H19FINO |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 4-fluoro-2-iodo-N-(4-methylhexan-2-yl)benzamide |
| SMILES | CCC(C)CC(C)NC(=O)c1ccc(F)cc1I |
| InChI | InChI=1S/C14H19FINO/c1-4-9(2)7-10(3)17-14(18)12-6-5-11(15)8-13(12)16/h5-6,8-10H,4,7H2,1-3H3,(H,17,18) |
| InChIKey | SMTJHJPZCJDVDP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|