C16H14FIN2O2S — CID 56579739
S-[4-[(4-fluoro-2-iodobenzoyl)amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56579739) has the molecular formula C16H14FIN2O2S and a molecular weight of 444.27 g/mol. Its IUPAC name is S-[4-[(4-fluoro-2-iodobenzoyl)amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[(4-fluoro-2-iodobenzoyl)amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56579739 |
| Molecular Formula | C16H14FIN2O2S |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | S-[4-[(4-fluoro-2-iodobenzoyl)amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(NC(=O)c2ccc(F)cc2I)cc1 |
| InChI | InChI=1S/C16H14FIN2O2S/c1-20(2)16(22)23-12-6-4-11(5-7-12)19-15(21)13-8-3-10(17)9-14(13)18/h3-9H,1-2H3,(H,19,21) |
| InChIKey | UKFLGDKUFCWIBX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|