C16H14F3N3O2S2 — CID 56576723
S-[4-[[2-(trifluoromethylsulfanyl)pyridine-3-carbonyl]amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56576723) has the molecular formula C16H14F3N3O2S2 and a molecular weight of 401.44 g/mol. Its IUPAC name is S-[4-[[2-(trifluoromethylsulfanyl)pyridine-3-carbonyl]amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[[2-(trifluoromethylsulfanyl)pyridine-3-carbonyl]amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56576723 |
| Molecular Formula | C16H14F3N3O2S2 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | S-[4-[[2-(trifluoromethylsulfanyl)pyridine-3-carbonyl]amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(NC(=O)c2cccnc2SC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F3N3O2S2/c1-22(2)15(24)25-11-7-5-10(6-8-11)21-13(23)12-4-3-9-20-14(12)26-16(17,18)19/h3-9H,1-2H3,(H,21,23) |
| InChIKey | ILSIEHIBDJIAIQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|