C22H23N3O4S — CID 56532884
S-[4-[[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56532884) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is S-[4-[[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56532884 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | S-[4-[[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | Cc1noc(C)c1COc1ccccc1C(=O)Nc1ccc(SC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C22H23N3O4S/c1-14-19(15(2)29-24-14)13-28-20-8-6-5-7-18(20)21(26)23-16-9-11-17(12-10-16)30-22(27)25(3)4/h5-12H,13H2,1-4H3,(H,23,26) |
| InChIKey | VHAKSKJRZLFKDR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|