C18H17N3O3 — CID 35828889
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-pyridin-4-ylbenzamide (PubChem CID 35828889) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-pyridin-4-ylbenzamide.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 35828889 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-pyridin-4-ylbenzamide |
| SMILES | Cc1noc(C)c1COc1ccccc1C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C18H17N3O3/c1-12-16(13(2)24-21-12)11-23-17-6-4-3-5-15(17)18(22)20-14-7-9-19-10-8-14/h3-10H,11H2,1-2H3,(H,19,20,22) |
| InChIKey | BPNZILWNHKTEBT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |