C15H10F3N3O2S — CID 47847759
N-[4-(cyanomethoxy)phenyl]-2-(trifluoromethylsulfanyl)pyridine-3-carboxamide (PubChem CID 47847759) has the molecular formula C15H10F3N3O2S and a molecular weight of 353.33 g/mol. Its IUPAC name is N-[4-(cyanomethoxy)phenyl]-2-(trifluoromethylsulfanyl)pyridine-3-carboxamide.
| Compound Name | N-[4-(cyanomethoxy)phenyl]-2-(trifluoromethylsulfanyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 47847759 |
| Molecular Formula | C15H10F3N3O2S |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-[4-(cyanomethoxy)phenyl]-2-(trifluoromethylsulfanyl)pyridine-3-carboxamide |
| SMILES | N#CCOc1ccc(NC(=O)c2cccnc2SC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F3N3O2S/c16-15(17,18)24-14-12(2-1-8-20-14)13(22)21-10-3-5-11(6-4-10)23-9-7-19/h1-6,8H,9H2,(H,21,22) |
| InChIKey | NCDUCEAPVLXCAG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |