C16H11F2N3O3S2 — CID 166380102
2-fluoro-N'-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonyl]benzohydrazide (PubChem CID 166380102) has the molecular formula C16H11F2N3O3S2 and a molecular weight of 395.41 g/mol. Its IUPAC name is 2-fluoro-N'-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonyl]benzohydrazide |
|---|---|
| PubChem CID | 166380102 |
| Molecular Formula | C16H11F2N3O3S2 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | 2-fluoro-N'-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonyl]benzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1cnc(-c2ccc(F)cc2)s1)c1ccccc1F |
| InChI | InChI=1S/C16H11F2N3O3S2/c17-11-7-5-10(6-8-11)16-19-9-14(25-16)26(23,24)21-20-15(22)12-3-1-2-4-13(12)18/h1-9,21H,(H,20,22) |
| InChIKey | MUZUKZSTYDUADB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|