C17H10FN3O4S2 — CID 167476005
3-cyano-4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]benzoic acid (PubChem CID 167476005) has the molecular formula C17H10FN3O4S2 and a molecular weight of 403.42 g/mol. Its IUPAC name is 3-cyano-4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]benzoic acid.
| Compound Name | 3-cyano-4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 167476005 |
| Molecular Formula | C17H10FN3O4S2 |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 3-cyano-4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]benzoic acid |
| SMILES | N#Cc1cc(C(=O)O)ccc1NS(=O)(=O)c1cnc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C17H10FN3O4S2/c18-13-4-1-10(2-5-13)16-20-9-15(26-16)27(24,25)21-14-6-3-11(17(22)23)7-12(14)8-19/h1-7,9,21H,(H,22,23) |
| InChIKey | IBBJZEUYCNJSJH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |