C18H20ClN3O4 — CID 55917649
N-[2-[2-[(4-chlorobenzoyl)amino]ethylamino]-2-oxoethyl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 55917649) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is N-[2-[2-[(4-chlorobenzoyl)amino]ethylamino]-2-oxoethyl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[2-[2-[(4-chlorobenzoyl)amino]ethylamino]-2-oxoethyl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 55917649 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-[2-[2-[(4-chlorobenzoyl)amino]ethylamino]-2-oxoethyl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(=O)NCCNC(=O)c2ccc(Cl)cc2)c(C)o1 |
| InChI | InChI=1S/C18H20ClN3O4/c1-11-9-15(12(2)26-11)18(25)22-10-16(23)20-7-8-21-17(24)13-3-5-14(19)6-4-13/h3-6,9H,7-8,10H2,1-2H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | DCLUSCVDCNXCBU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|