C20H26N2O5 — CID 26878579
N-[3-(3,4-dipropoxyanilino)-3-oxopropyl]furan-2-carboxamide (PubChem CID 26878579) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-[3-(3,4-dipropoxyanilino)-3-oxopropyl]furan-2-carboxamide.
| Compound Name | N-[3-(3,4-dipropoxyanilino)-3-oxopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 26878579 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-[3-(3,4-dipropoxyanilino)-3-oxopropyl]furan-2-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)CCNC(=O)c2ccco2)cc1OCCC |
| InChI | InChI=1S/C20H26N2O5/c1-3-11-25-16-8-7-15(14-18(16)26-12-4-2)22-19(23)9-10-21-20(24)17-6-5-13-27-17/h5-8,13-14H,3-4,9-12H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | WLRSKTWBEKVYTB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |