C14H18N4O3 — CID 115619809
N-[3-oxo-3-[(5-propyl-1H-pyrazol-3-yl)amino]propyl]furan-2-carboxamide (PubChem CID 115619809) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-[3-oxo-3-[(5-propyl-1H-pyrazol-3-yl)amino]propyl]furan-2-carboxamide.
| Compound Name | N-[3-oxo-3-[(5-propyl-1H-pyrazol-3-yl)amino]propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 115619809 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-[3-oxo-3-[(5-propyl-1H-pyrazol-3-yl)amino]propyl]furan-2-carboxamide |
| SMILES | CCCc1cc(NC(=O)CCNC(=O)c2ccco2)n[nH]1 |
| InChI | InChI=1S/C14H18N4O3/c1-2-4-10-9-12(18-17-10)16-13(19)6-7-15-14(20)11-5-3-8-21-11/h3,5,8-9H,2,4,6-7H2,1H3,(H,15,20)(H2,16,17,18,19) |
| InChIKey | GOVCUVAAKCWWNN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |