C11H12N4O3 — CID 61393596
N-[3-oxo-3-(1H-pyrazol-5-ylamino)propyl]furan-2-carboxamide (PubChem CID 61393596) has the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is N-[3-oxo-3-(1H-pyrazol-5-ylamino)propyl]furan-2-carboxamide.
| Compound Name | N-[3-oxo-3-(1H-pyrazol-5-ylamino)propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 61393596 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | N-[3-oxo-3-(1H-pyrazol-5-ylamino)propyl]furan-2-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccco1)Nc1ccn[nH]1 |
| InChI | InChI=1S/C11H12N4O3/c16-10(14-9-3-6-13-15-9)4-5-12-11(17)8-2-1-7-18-8/h1-3,6-7H,4-5H2,(H,12,17)(H2,13,14,15,16) |
| InChIKey | YILAOSOINXRMAM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |