C10H10N4O3 — CID 61393852
N-[2-oxo-2-(1H-pyrazol-5-ylamino)ethyl]furan-2-carboxamide (PubChem CID 61393852) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is N-[2-oxo-2-(1H-pyrazol-5-ylamino)ethyl]furan-2-carboxamide.
| Compound Name | N-[2-oxo-2-(1H-pyrazol-5-ylamino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 61393852 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-[2-oxo-2-(1H-pyrazol-5-ylamino)ethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccco1)Nc1ccn[nH]1 |
| InChI | InChI=1S/C10H10N4O3/c15-9(13-8-3-4-12-14-8)6-11-10(16)7-2-1-5-17-7/h1-5H,6H2,(H,11,16)(H2,12,13,14,15) |
| InChIKey | OEDCGNCGIVMFEF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |