C12H10N2O5S — CID 43357386
2-[[2-(furan-2-carbonylamino)acetyl]amino]thiophene-3-carboxylic acid (PubChem CID 43357386) has the molecular formula C12H10N2O5S and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-[[2-(furan-2-carbonylamino)acetyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[2-(furan-2-carbonylamino)acetyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 43357386 |
| Molecular Formula | C12H10N2O5S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2-[[2-(furan-2-carbonylamino)acetyl]amino]thiophene-3-carboxylic acid |
| SMILES | O=C(CNC(=O)c1ccco1)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C12H10N2O5S/c15-9(6-13-10(16)8-2-1-4-19-8)14-11-7(12(17)18)3-5-20-11/h1-5H,6H2,(H,13,16)(H,14,15)(H,17,18) |
| InChIKey | DCJQPOGLGGLZIL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |