C14H18ClN3O3S — CID 119628741
N-[3-[(2-amino-2-methylpropyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide;hydrochloride (PubChem CID 119628741) has the molecular formula C14H18ClN3O3S and a molecular weight of 343.84 g/mol. Its IUPAC name is N-[3-[(2-amino-2-methylpropyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide;hydrochloride.
| Compound Name | N-[3-[(2-amino-2-methylpropyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119628741 |
| Molecular Formula | C14H18ClN3O3S |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-[3-[(2-amino-2-methylpropyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide;hydrochloride |
| SMILES | CC(C)(N)CNC(=O)c1ccsc1NC(=O)c1ccco1.Cl |
| InChI | InChI=1S/C14H17N3O3S.ClH/c1-14(2,15)8-16-11(18)9-5-7-21-13(9)17-12(19)10-4-3-6-20-10;/h3-7H,8,15H2,1-2H3,(H,16,18)(H,17,19);1H |
| InChIKey | XZBJUNLZJNWDTN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |