C13H12N2O5S — CID 63615187
2-[[2-(furan-2-carbonylamino)acetyl]amino]-5-methylthiophene-3-carboxylic acid (PubChem CID 63615187) has the molecular formula C13H12N2O5S and a molecular weight of 308.31 g/mol. Its IUPAC name is 2-[[2-(furan-2-carbonylamino)acetyl]amino]-5-methylthiophene-3-carboxylic acid.
| Compound Name | 2-[[2-(furan-2-carbonylamino)acetyl]amino]-5-methylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63615187 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-[[2-(furan-2-carbonylamino)acetyl]amino]-5-methylthiophene-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(NC(=O)CNC(=O)c2ccco2)s1 |
| InChI | InChI=1S/C13H12N2O5S/c1-7-5-8(13(18)19)12(21-7)15-10(16)6-14-11(17)9-3-2-4-20-9/h2-5H,6H2,1H3,(H,14,17)(H,15,16)(H,18,19) |
| InChIKey | UZEVNYVEYKYVAY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |