C18H20N2O6S2 — CID 24859424
2-[[6-[(3-carboxy-5-methylthiophen-2-yl)amino]-6-oxohexanoyl]amino]-5-methylthiophene-3-carboxylic acid (PubChem CID 24859424) has the molecular formula C18H20N2O6S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-[[6-[(3-carboxy-5-methylthiophen-2-yl)amino]-6-oxohexanoyl]amino]-5-methylthiophene-3-carboxylic acid.
| Compound Name | 2-[[6-[(3-carboxy-5-methylthiophen-2-yl)amino]-6-oxohexanoyl]amino]-5-methylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 24859424 |
| Molecular Formula | C18H20N2O6S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-[[6-[(3-carboxy-5-methylthiophen-2-yl)amino]-6-oxohexanoyl]amino]-5-methylthiophene-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(NC(=O)CCCCC(=O)Nc2sc(C)cc2C(=O)O)s1 |
| InChI | InChI=1S/C18H20N2O6S2/c1-9-7-11(17(23)24)15(27-9)19-13(21)5-3-4-6-14(22)20-16-12(18(25)26)8-10(2)28-16/h7-8H,3-6H2,1-2H3,(H,19,21)(H,20,22)(H,23,24)(H,25,26) |
| InChIKey | IZOJZNVTBWLONZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|