C10H10N2O3S2 — CID 55249535
2-[[2-(cyanomethylsulfanyl)acetyl]amino]-5-methylthiophene-3-carboxylic acid (PubChem CID 55249535) has the molecular formula C10H10N2O3S2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-[[2-(cyanomethylsulfanyl)acetyl]amino]-5-methylthiophene-3-carboxylic acid.
| Compound Name | 2-[[2-(cyanomethylsulfanyl)acetyl]amino]-5-methylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 55249535 |
| Molecular Formula | C10H10N2O3S2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 2-[[2-(cyanomethylsulfanyl)acetyl]amino]-5-methylthiophene-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(NC(=O)CSCC#N)s1 |
| InChI | InChI=1S/C10H10N2O3S2/c1-6-4-7(10(14)15)9(17-6)12-8(13)5-16-3-2-11/h4H,3,5H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | VKWMFHLHRAXOEZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|