C7H8N2O3S — CID 63617341
2-(carbamoylamino)-5-methylthiophene-3-carboxylic acid (PubChem CID 63617341) has the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-methylthiophene-3-carboxylic acid.
| Compound Name | 2-(carbamoylamino)-5-methylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63617341 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 2-(carbamoylamino)-5-methylthiophene-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(NC(N)=O)s1 |
| InChI | InChI=1S/C7H8N2O3S/c1-3-2-4(6(10)11)5(13-3)9-7(8)12/h2H,1H3,(H,10,11)(H3,8,9,12) |
| InChIKey | NQYJFBAIVNSTKA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |