C21H21N3O3 — CID 9293667
N-[2-(2,2-dibenzylhydrazinyl)-2-oxoethyl]furan-2-carboxamide (PubChem CID 9293667) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-[2-(2,2-dibenzylhydrazinyl)-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-(2,2-dibenzylhydrazinyl)-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9293667 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-[2-(2,2-dibenzylhydrazinyl)-2-oxoethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccco1)NN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H21N3O3/c25-20(14-22-21(26)19-12-7-13-27-19)23-24(15-17-8-3-1-4-9-17)16-18-10-5-2-6-11-18/h1-13H,14-16H2,(H,22,26)(H,23,25) |
| InChIKey | FXGDEUNSWBFSCM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|