C9H13N3O3 — CID 104621777
3-oxo-3-[(5-propyl-1H-pyrazol-3-yl)amino]propanoic acid (PubChem CID 104621777) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-oxo-3-[(5-propyl-1H-pyrazol-3-yl)amino]propanoic acid.
| Compound Name | 3-oxo-3-[(5-propyl-1H-pyrazol-3-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 104621777 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3-oxo-3-[(5-propyl-1H-pyrazol-3-yl)amino]propanoic acid |
| SMILES | CCCc1cc(NC(=O)CC(=O)O)n[nH]1 |
| InChI | InChI=1S/C9H13N3O3/c1-2-3-6-4-7(12-11-6)10-8(13)5-9(14)15/h4H,2-3,5H2,1H3,(H,14,15)(H2,10,11,12,13) |
| InChIKey | CHYSVAWHUSXUBT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|